C11H21N — CID 107189375
cyclopropyl-(2,2-dimethylcyclopentyl)methanamine (PubChem CID 107189375) has the molecular formula C11H21N and a molecular weight of 167.30 g/mol. Its IUPAC name is cyclopropyl-(2,2-dimethylcyclopentyl)methanamine.
| Compound Name | cyclopropyl-(2,2-dimethylcyclopentyl)methanamine |
|---|---|
| PubChem CID | 107189375 |
| Molecular Formula | C11H21N |
| Molecular Weight | 167.30 g/mol |
| Exact Mass | 167.17 |
| IUPAC Name | cyclopropyl-(2,2-dimethylcyclopentyl)methanamine |
| SMILES | CC1(C)CCCC1C(N)C1CC1 |
| InChI | InChI=1S/C11H21N/c1-11(2)7-3-4-9(11)10(12)8-5-6-8/h8-10H,3-7,12H2,1-2H3 |
| InChIKey | UZQJKLIQGAZFAQ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.30 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |