C11H22N2 — CID 107194152
[cyclopropyl-(2,2-dimethylcyclopentyl)methyl]hydrazine (PubChem CID 107194152) has the molecular formula C11H22N2 and a molecular weight of 182.31 g/mol. Its IUPAC name is [cyclopropyl-(2,2-dimethylcyclopentyl)methyl]hydrazine.
| Compound Name | [cyclopropyl-(2,2-dimethylcyclopentyl)methyl]hydrazine |
|---|---|
| PubChem CID | 107194152 |
| Molecular Formula | C11H22N2 |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.18 |
| IUPAC Name | [cyclopropyl-(2,2-dimethylcyclopentyl)methyl]hydrazine |
| SMILES | CC1(C)CCCC1C(NN)C1CC1 |
| InChI | InChI=1S/C11H22N2/c1-11(2)7-3-4-9(11)10(13-12)8-5-6-8/h8-10,13H,3-7,12H2,1-2H3 |
| InChIKey | AWWFNUCPHFRWNL-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|