C12H23NO — CID 107188775
(2,2-dimethylcyclopentyl)-(oxolan-3-yl)methanamine (PubChem CID 107188775) has the molecular formula C12H23NO and a molecular weight of 197.32 g/mol. Its IUPAC name is (2,2-dimethylcyclopentyl)-(oxolan-3-yl)methanamine.
| Compound Name | (2,2-dimethylcyclopentyl)-(oxolan-3-yl)methanamine |
|---|---|
| PubChem CID | 107188775 |
| Molecular Formula | C12H23NO |
| Molecular Weight | 197.32 g/mol |
| Exact Mass | 197.18 |
| IUPAC Name | (2,2-dimethylcyclopentyl)-(oxolan-3-yl)methanamine |
| SMILES | CC1(C)CCCC1C(N)C1CCOC1 |
| InChI | InChI=1S/C12H23NO/c1-12(2)6-3-4-10(12)11(13)9-5-7-14-8-9/h9-11H,3-8,13H2,1-2H3 |
| InChIKey | PAPLQHWCMZZGOB-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.32 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |