C15H20Cl2O2 — CID 103452109
1-[2-(2,6-dichlorophenyl)-1-hydroxyethyl]cycloheptan-1-ol (PubChem CID 103452109) has the molecular formula C15H20Cl2O2 and a molecular weight of 303.23 g/mol. Its IUPAC name is 1-[2-(2,6-dichlorophenyl)-1-hydroxyethyl]cycloheptan-1-ol.
| Compound Name | 1-[2-(2,6-dichlorophenyl)-1-hydroxyethyl]cycloheptan-1-ol |
|---|---|
| PubChem CID | 103452109 |
| Molecular Formula | C15H20Cl2O2 |
| Molecular Weight | 303.23 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | 1-[2-(2,6-dichlorophenyl)-1-hydroxyethyl]cycloheptan-1-ol |
| SMILES | OC(Cc1c(Cl)cccc1Cl)C1(O)CCCCCC1 |
| InChI | InChI=1S/C15H20Cl2O2/c16-12-6-5-7-13(17)11(12)10-14(18)15(19)8-3-1-2-4-9-15/h5-7,14,18-19H,1-4,8-10H2 |
| InChIKey | BZZOLZUHBTXGRK-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.23 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |