C13H20O2S — CID 103452194
1-(1-hydroxy-2-thiophen-3-ylethyl)cycloheptan-1-ol (PubChem CID 103452194) has the molecular formula C13H20O2S and a molecular weight of 240.37 g/mol. Its IUPAC name is 1-(1-hydroxy-2-thiophen-3-ylethyl)cycloheptan-1-ol.
| Compound Name | 1-(1-hydroxy-2-thiophen-3-ylethyl)cycloheptan-1-ol |
|---|---|
| PubChem CID | 103452194 |
| Molecular Formula | C13H20O2S |
| Molecular Weight | 240.37 g/mol |
| Exact Mass | 240.12 |
| IUPAC Name | 1-(1-hydroxy-2-thiophen-3-ylethyl)cycloheptan-1-ol |
| SMILES | OC(Cc1ccsc1)C1(O)CCCCCC1 |
| InChI | InChI=1S/C13H20O2S/c14-12(9-11-5-8-16-10-11)13(15)6-3-1-2-4-7-13/h5,8,10,12,14-15H,1-4,6-7,9H2 |
| InChIKey | JTLPIGVURFPLPS-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.37 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |