C13H20OS — CID 115798476
1-(1-methylcyclopentyl)-3-thiophen-3-ylpropan-1-ol (PubChem CID 115798476) has the molecular formula C13H20OS and a molecular weight of 224.37 g/mol. Its IUPAC name is 1-(1-methylcyclopentyl)-3-thiophen-3-ylpropan-1-ol.
| Compound Name | 1-(1-methylcyclopentyl)-3-thiophen-3-ylpropan-1-ol |
|---|---|
| PubChem CID | 115798476 |
| Molecular Formula | C13H20OS |
| Molecular Weight | 224.37 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | 1-(1-methylcyclopentyl)-3-thiophen-3-ylpropan-1-ol |
| SMILES | CC1(C(O)CCc2ccsc2)CCCC1 |
| InChI | InChI=1S/C13H20OS/c1-13(7-2-3-8-13)12(14)5-4-11-6-9-15-10-11/h6,9-10,12,14H,2-5,7-8H2,1H3 |
| InChIKey | YATOPFXOUWHJGT-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.37 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |