C15H22O3 — CID 100951242
(1R,2R,3R,4R)-3-[furan-2-yl(hydroxy)methyl]-1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol (PubChem CID 100951242) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is (1R,2R,3R,4R)-3-[furan-2-yl(hydroxy)methyl]-1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol.
| Compound Name | (1R,2R,3R,4R)-3-[furan-2-yl(hydroxy)methyl]-1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol |
|---|---|
| PubChem CID | 100951242 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | (1R,2R,3R,4R)-3-[furan-2-yl(hydroxy)methyl]-1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(C)[C@H](O)[C@@H]2C(O)c1ccco1 |
| InChI | InChI=1S/C15H22O3/c1-14(2)9-6-7-15(14,3)13(17)11(9)12(16)10-5-4-8-18-10/h4-5,8-9,11-13,16-17H,6-7H2,1-3H3/t9-,11+,12?,13-,15+/m1/s1 |
| InChIKey | BXJQRUYNAAVLDH-PTZXVTCASA-N |
| XLogP | 2.75 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |