C10H18O2 — CID 101471521
(2S,3R)-1,7,7-trimethylbicyclo[2.2.1]heptane-2,3-diol (PubChem CID 101471521) has the molecular formula C10H18O2 and a molecular weight of 170.25 g/mol. Its IUPAC name is (2S,3R)-1,7,7-trimethylbicyclo[2.2.1]heptane-2,3-diol.
| Compound Name | (2S,3R)-1,7,7-trimethylbicyclo[2.2.1]heptane-2,3-diol |
|---|---|
| PubChem CID | 101471521 |
| Molecular Formula | C10H18O2 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.13 |
| IUPAC Name | (2S,3R)-1,7,7-trimethylbicyclo[2.2.1]heptane-2,3-diol |
| SMILES | CC1(C)C2CCC1(C)[C@H](O)[C@@H]2O |
| InChI | InChI=1S/C10H18O2/c1-9(2)6-4-5-10(9,3)8(12)7(6)11/h6-8,11-12H,4-5H2,1-3H3/t6?,7-,8-,10?/m1/s1 |
| InChIKey | AYEOSGBMQHXVER-FATLICPNSA-N |
| XLogP | 1.16 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |