C20H34O2Se2 — CID 15349595
(1R,2R,3S,4S)-3-[[(1S,2S,3R,4R)-3-hydroxy-4,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]diselanyl]-1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol (PubChem CID 15349595) has the molecular formula C20H34O2Se2 and a molecular weight of 464.41 g/mol. Its IUPAC name is (1R,2R,3S,4S)-3-[[(1S,2S,3R,4R)-3-hydroxy-4,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]diselanyl]-1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol.
| Compound Name | (1R,2R,3S,4S)-3-[[(1S,2S,3R,4R)-3-hydroxy-4,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]diselanyl]-1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol |
|---|---|
| PubChem CID | 15349595 |
| Molecular Formula | C20H34O2Se2 |
| Molecular Weight | 464.41 g/mol |
| Exact Mass | 466.09 |
| IUPAC Name | (1R,2R,3S,4S)-3-[[(1S,2S,3R,4R)-3-hydroxy-4,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]diselanyl]-1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(C)[C@@H](O)[C@H]2[Se][Se][C@H]1[C@H]2CC[C@@](C)([C@H]1O)C2(C)C |
| InChI | InChI=1S/C20H34O2Se2/c1-17(2)11-7-9-19(17,5)15(21)13(11)23-24-14-12-8-10-20(6,16(14)22)18(12,3)4/h11-16,21-22H,7-10H2,1-6H3/t11-,12-,13+,14+,15+,16+,19+,20+/m1/s1 |
| InChIKey | VWECPWWNHAWTES-CILRADMLSA-N |
| XLogP | 3.52 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.41 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|