C13H23NO3 — CID 7054096
ethyl N-[(1S,2R,3R,4R)-3-hydroxy-4,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]carbamate (PubChem CID 7054096) has the molecular formula C13H23NO3 and a molecular weight of 241.33 g/mol. Its IUPAC name is ethyl N-[(1S,2R,3R,4R)-3-hydroxy-4,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]carbamate.
| Compound Name | ethyl N-[(1S,2R,3R,4R)-3-hydroxy-4,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]carbamate |
|---|---|
| PubChem CID | 7054096 |
| Molecular Formula | C13H23NO3 |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.17 |
| IUPAC Name | ethyl N-[(1S,2R,3R,4R)-3-hydroxy-4,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]carbamate |
| SMILES | CCOC(=O)N[C@@H]1[C@H]2CC[C@@](C)([C@H]1O)C2(C)C |
| InChI | InChI=1S/C13H23NO3/c1-5-17-11(16)14-9-8-6-7-13(4,10(9)15)12(8,2)3/h8-10,15H,5-7H2,1-4H3,(H,14,16)/t8-,9-,10+,13+/m1/s1 |
| InChIKey | ZPRXYQLZYUPPGR-DNJQJEMRSA-N |
| XLogP | 1.92 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |