C15H27BrO3S — CID 25058623
(2-ethoxy-2-oxoethyl)-[(1S,2R,3S,4R)-3-hydroxy-4,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]-methylsulfanium bromide (PubChem CID 25058623) has the molecular formula C15H27BrO3S and a molecular weight of 367.35 g/mol. Its IUPAC name is (2-ethoxy-2-oxoethyl)-[(1S,2R,3S,4R)-3-hydroxy-4,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]-methylsulfanium bromide.
| Compound Name | (2-ethoxy-2-oxoethyl)-[(1S,2R,3S,4R)-3-hydroxy-4,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]-methylsulfanium bromide |
|---|---|
| PubChem CID | 25058623 |
| Molecular Formula | C15H27BrO3S |
| Molecular Weight | 367.35 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | (2-ethoxy-2-oxoethyl)-[(1S,2R,3S,4R)-3-hydroxy-4,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]-methylsulfanium bromide |
| SMILES | CCOC(=O)C[S+](C)[C@@H]1[C@H]2CC[C@@](C)([C@@H]1O)C2(C)C.[Br-] |
| InChI | InChI=1S/C15H27O3S.BrH/c1-6-18-11(16)9-19(5)12-10-7-8-15(4,13(12)17)14(10,2)3;/h10,12-13,17H,6-9H2,1-5H3;1H/q+1;/p-1/t10-,12-,13-,15+,19?;/m1./s1 |
| InChIKey | YYANHJDISLRDAP-WZRZRHORSA-M |
| XLogP | -1.01 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.35 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|