C16H28N2O4 — CID 11868331
ethyl N-[(1R,2S,3R,4S)-3-(ethoxycarbonylamino)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]carbamate (PubChem CID 11868331) has the molecular formula C16H28N2O4 and a molecular weight of 312.41 g/mol. Its IUPAC name is ethyl N-[(1R,2S,3R,4S)-3-(ethoxycarbonylamino)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]carbamate.
| Compound Name | ethyl N-[(1R,2S,3R,4S)-3-(ethoxycarbonylamino)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]carbamate |
|---|---|
| PubChem CID | 11868331 |
| Molecular Formula | C16H28N2O4 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | ethyl N-[(1R,2S,3R,4S)-3-(ethoxycarbonylamino)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]carbamate |
| SMILES | CCOC(=O)N[C@@H]1[C@H]2CC[C@@](C)([C@@H]1NC(=O)OCC)C2(C)C |
| InChI | InChI=1S/C16H28N2O4/c1-6-21-13(19)17-11-10-8-9-16(5,15(10,3)4)12(11)18-14(20)22-7-2/h10-12H,6-9H2,1-5H3,(H,17,19)(H,18,20)/t10-,11-,12-,16+/m1/s1 |
| InChIKey | QLDRUUOHQNVXRC-QHSOUUPTSA-N |
| XLogP | 2.67 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |