C24H28N2O2 — CID 100805840
N-[(1R,2R,3R,4R)-3-benzamido-4,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]benzamide (PubChem CID 100805840) has the molecular formula C24H28N2O2 and a molecular weight of 376.50 g/mol. Its IUPAC name is N-[(1R,2R,3R,4R)-3-benzamido-4,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]benzamide.
| Compound Name | N-[(1R,2R,3R,4R)-3-benzamido-4,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]benzamide |
|---|---|
| PubChem CID | 100805840 |
| Molecular Formula | C24H28N2O2 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | N-[(1R,2R,3R,4R)-3-benzamido-4,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]benzamide |
| SMILES | CC1(C)[C@H]2CC[C@@]1(C)[C@@H](NC(=O)c1ccccc1)[C@@H]2NC(=O)c1ccccc1 |
| InChI | InChI=1S/C24H28N2O2/c1-23(2)18-14-15-24(23,3)20(26-22(28)17-12-8-5-9-13-17)19(18)25-21(27)16-10-6-4-7-11-16/h4-13,18-20H,14-15H2,1-3H3,(H,25,27)(H,26,28)/t18-,19+,20-,24-/m0/s1 |
| InChIKey | RVXBNSBZNVTNRD-VKDGWMQASA-N |
| XLogP | 4.04 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |