C12H22N4O2 — CID 100805855
[(1R,2R,3R,4R)-3-(carbamoylamino)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]urea (PubChem CID 100805855) has the molecular formula C12H22N4O2 and a molecular weight of 254.33 g/mol. Its IUPAC name is [(1R,2R,3R,4R)-3-(carbamoylamino)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]urea.
| Compound Name | [(1R,2R,3R,4R)-3-(carbamoylamino)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]urea |
|---|---|
| PubChem CID | 100805855 |
| Molecular Formula | C12H22N4O2 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.17 |
| IUPAC Name | [(1R,2R,3R,4R)-3-(carbamoylamino)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]urea |
| SMILES | CC1(C)[C@H]2CC[C@@]1(C)[C@@H](NC(N)=O)[C@@H]2NC(N)=O |
| InChI | InChI=1S/C12H22N4O2/c1-11(2)6-4-5-12(11,3)8(16-10(14)18)7(6)15-9(13)17/h6-8H,4-5H2,1-3H3,(H3,13,15,17)(H3,14,16,18)/t6-,7+,8-,12-/m0/s1 |
| InChIKey | GDRJLMMDAIYYRU-MEUQOTJWSA-N |
| XLogP | 0.52 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |