C24H30N4S2 — CID 18389898
1-phenyl-3-[(1S,2S,3R,4S)-1,7,7-trimethyl-3-(phenylcarbamothioylamino)-2-bicyclo[2.2.1]heptanyl]thiourea (PubChem CID 18389898) has the molecular formula C24H30N4S2 and a molecular weight of 438.67 g/mol. Its IUPAC name is 1-phenyl-3-[(1S,2S,3R,4S)-1,7,7-trimethyl-3-(phenylcarbamothioylamino)-2-bicyclo[2.2.1]heptanyl]thiourea.
| Compound Name | 1-phenyl-3-[(1S,2S,3R,4S)-1,7,7-trimethyl-3-(phenylcarbamothioylamino)-2-bicyclo[2.2.1]heptanyl]thiourea |
|---|---|
| PubChem CID | 18389898 |
| Molecular Formula | C24H30N4S2 |
| Molecular Weight | 438.67 g/mol |
| Exact Mass | 438.19 |
| IUPAC Name | 1-phenyl-3-[(1S,2S,3R,4S)-1,7,7-trimethyl-3-(phenylcarbamothioylamino)-2-bicyclo[2.2.1]heptanyl]thiourea |
| SMILES | CC1(C)[C@@H]2CC[C@]1(C)[C@H](NC(=S)Nc1ccccc1)[C@@H]2NC(=S)Nc1ccccc1 |
| InChI | InChI=1S/C24H30N4S2/c1-23(2)18-14-15-24(23,3)20(28-22(30)26-17-12-8-5-9-13-17)19(18)27-21(29)25-16-10-6-4-7-11-16/h4-13,18-20H,14-15H2,1-3H3,(H2,25,27,29)(H2,26,28,30)/t18-,19-,20-,24-/m1/s1 |
| InChIKey | QGKBSHAUAIEERO-DBYOASNMSA-N |
| XLogP | 5.15 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.67 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|