C13H16N2O2S — CID 10539560
trans-(1R,2R)-2-(phenylcarbamothioylamino)cyclopentane-1-carboxylic acid (PubChem CID 10539560) has the molecular formula C13H16N2O2S and a molecular weight of 264.35 g/mol. Its IUPAC name is trans-(1R,2R)-2-(phenylcarbamothioylamino)cyclopentane-1-carboxylic acid.
| Compound Name | trans-(1R,2R)-2-(phenylcarbamothioylamino)cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 10539560 |
| Molecular Formula | C13H16N2O2S |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | trans-(1R,2R)-2-(phenylcarbamothioylamino)cyclopentane-1-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CCC[C@H]1NC(=S)Nc1ccccc1 |
| InChI | InChI=1S/C13H16N2O2S/c16-12(17)10-7-4-8-11(10)15-13(18)14-9-5-2-1-3-6-9/h1-3,5-6,10-11H,4,7-8H2,(H,16,17)(H2,14,15,18)/t10-,11-/m1/s1 |
| InChIKey | VZLKZELIZUHRKZ-GHMZBOCLSA-N |
| XLogP | 2.23 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|