C7H12N2O2S — CID 15534342
cis-(1R,2S)-2-(carbamothioylamino)cyclopentane-1-carboxylic acid (PubChem CID 15534342) has the molecular formula C7H12N2O2S and a molecular weight of 188.25 g/mol. Its IUPAC name is cis-(1R,2S)-2-(carbamothioylamino)cyclopentane-1-carboxylic acid.
| Compound Name | cis-(1R,2S)-2-(carbamothioylamino)cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 15534342 |
| Molecular Formula | C7H12N2O2S |
| Molecular Weight | 188.25 g/mol |
| Exact Mass | 188.06 |
| IUPAC Name | cis-(1R,2S)-2-(carbamothioylamino)cyclopentane-1-carboxylic acid |
| SMILES | NC(=S)N[C@H]1CCC[C@H]1C(=O)O |
| InChI | InChI=1S/C7H12N2O2S/c8-7(12)9-5-3-1-2-4(5)6(10)11/h4-5H,1-3H2,(H,10,11)(H3,8,9,12)/t4-,5+/m1/s1 |
| InChIKey | LPUOIEAHWGREMB-UHNVWZDZSA-N |
| XLogP | 0.07 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.25 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|