About cis-(1S,2R)-2-(methylamino)cyclohexane-1-carboxylic acid
cis-(1S,2R)-2-(methylamino)cyclohexane-1-carboxylic acid (PubChem CID 66806131) has the molecular formula C8H15NO2
and a molecular weight of 157.21 g/mol. Its IUPAC name is cis-(1S,2R)-2-(methylamino)cyclohexane-1-carboxylic acid.
Analyze cis-(1S,2R)-2-(methylamino)cyclohexane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(1S,2R)-2-(methylamino)cyclohexane-1-carboxylic acid?
The IUPAC name of cis-(1S,2R)-2-(methylamino)cyclohexane-1-carboxylic acid (CID 66806131) is cis-(1S,2R)-2-(methylamino)cyclohexane-1-carboxylic acid.
What is the SMILES notation for cis-(1S,2R)-2-(methylamino)cyclohexane-1-carboxylic acid?
The canonical SMILES for cis-(1S,2R)-2-(methylamino)cyclohexane-1-carboxylic acid is CN[C@@H]1CCCC[C@@H]1C(=O)O.
What is the InChIKey of cis-(1S,2R)-2-(methylamino)cyclohexane-1-carboxylic acid?
The InChIKey is WBWLQVJMCJPYHB-NKWVEPMBSA-N. The full InChI is InChI=1S/C8H15NO2/c1-9-7-5-3-2-4-6(7)8(10)11/h6-7,9H,2-5H2,1H3,(H,10,11)/t6-,7+/m0/s1.
What are the key properties of cis-(1S,2R)-2-(methylamino)cyclohexane-1-carboxylic acid?
cis-(1S,2R)-2-(methylamino)cyclohexane-1-carboxylic acid has a molecular weight of 157.21 g/mol, XLogP of 0.85, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(1S,2R)-2-(methylamino)cyclohexane-1-carboxylic acid is sourced from PubChem (CID 66806131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).