C7H10N2O2 — CID 164660205
2-(cyanoamino)cyclopentane-1-carboxylic acid (PubChem CID 164660205) has the molecular formula C7H10N2O2 and a molecular weight of 154.17 g/mol. Its IUPAC name is 2-(cyanoamino)cyclopentane-1-carboxylic acid.
| Compound Name | 2-(cyanoamino)cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 164660205 |
| Molecular Formula | C7H10N2O2 |
| Molecular Weight | 154.17 g/mol |
| Exact Mass | 154.07 |
| IUPAC Name | 2-(cyanoamino)cyclopentane-1-carboxylic acid |
| SMILES | N#CNC1CCCC1C(=O)O |
| InChI | InChI=1S/C7H10N2O2/c8-4-9-6-3-1-2-5(6)7(10)11/h5-6,9H,1-3H2,(H,10,11) |
| InChIKey | AXKIUCBULJYHSL-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 73.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.17 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|