C12H16N2S2 — CID 115675091
1-phenyl-3-(thian-3-yl)thiourea (PubChem CID 115675091) has the molecular formula C12H16N2S2 and a molecular weight of 252.41 g/mol. Its IUPAC name is 1-phenyl-3-(thian-3-yl)thiourea.
| Compound Name | 1-phenyl-3-(thian-3-yl)thiourea |
|---|---|
| PubChem CID | 115675091 |
| Molecular Formula | C12H16N2S2 |
| Molecular Weight | 252.41 g/mol |
| Exact Mass | 252.08 |
| IUPAC Name | 1-phenyl-3-(thian-3-yl)thiourea |
| SMILES | S=C(Nc1ccccc1)NC1CCCSC1 |
| InChI | InChI=1S/C12H16N2S2/c15-12(13-10-5-2-1-3-6-10)14-11-7-4-8-16-9-11/h1-3,5-6,11H,4,7-9H2,(H2,13,14,15) |
| InChIKey | BWPARSCLTZFGHE-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.41 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|