C20H28N2O2 — CID 10568303
N-[(1S,2R,3S,4R)-3-hydroxy-4,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]-3,4-dihydro-1H-isoquinoline-2-carboxamide (PubChem CID 10568303) has the molecular formula C20H28N2O2 and a molecular weight of 328.46 g/mol. Its IUPAC name is N-[(1S,2R,3S,4R)-3-hydroxy-4,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]-3,4-dihydro-1H-isoquinoline-2-carboxamide.
| Compound Name | N-[(1S,2R,3S,4R)-3-hydroxy-4,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]-3,4-dihydro-1H-isoquinoline-2-carboxamide |
|---|---|
| PubChem CID | 10568303 |
| Molecular Formula | C20H28N2O2 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | N-[(1S,2R,3S,4R)-3-hydroxy-4,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]-3,4-dihydro-1H-isoquinoline-2-carboxamide |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(C)[C@H](O)[C@@H]2NC(=O)N1CCc2ccccc2C1 |
| InChI | InChI=1S/C20H28N2O2/c1-19(2)15-8-10-20(19,3)17(23)16(15)21-18(24)22-11-9-13-6-4-5-7-14(13)12-22/h4-7,15-17,23H,8-12H2,1-3H3,(H,21,24)/t15-,16-,17-,20+/m1/s1 |
| InChIKey | IZHLIJLPZQLHOQ-VIPLHTEESA-N |
| XLogP | 2.94 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |