C14H25N3O3 — CID 99952297
ethyl N-[[(1S,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]carbamoylamino]carbamate (PubChem CID 99952297) has the molecular formula C14H25N3O3 and a molecular weight of 283.37 g/mol. Its IUPAC name is ethyl N-[[(1S,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]carbamoylamino]carbamate.
| Compound Name | ethyl N-[[(1S,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]carbamoylamino]carbamate |
|---|---|
| PubChem CID | 99952297 |
| Molecular Formula | C14H25N3O3 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.19 |
| IUPAC Name | ethyl N-[[(1S,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]carbamoylamino]carbamate |
| SMILES | CCOC(=O)NNC(=O)N[C@@H]1C[C@H]2CC[C@@]1(C)C2(C)C |
| InChI | InChI=1S/C14H25N3O3/c1-5-20-12(19)17-16-11(18)15-10-8-9-6-7-14(10,4)13(9,2)3/h9-10H,5-8H2,1-4H3,(H,17,19)(H2,15,16,18)/t9-,10-,14-/m1/s1 |
| InChIKey | DVWYAQGOINMJHN-GPCCPHFNSA-N |
| XLogP | 2.16 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|