C15H26N2O3 — CID 50936438
N'-ethoxy-N-[(1S,2S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]propanediamide (PubChem CID 50936438) has the molecular formula C15H26N2O3 and a molecular weight of 282.38 g/mol. Its IUPAC name is N'-ethoxy-N-[(1S,2S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]propanediamide.
| Compound Name | N'-ethoxy-N-[(1S,2S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]propanediamide |
|---|---|
| PubChem CID | 50936438 |
| Molecular Formula | C15H26N2O3 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.19 |
| IUPAC Name | N'-ethoxy-N-[(1S,2S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]propanediamide |
| SMILES | CCONC(=O)CC(=O)N[C@H]1C[C@@H]2CC[C@@]1(C)C2(C)C |
| InChI | InChI=1S/C15H26N2O3/c1-5-20-17-13(19)9-12(18)16-11-8-10-6-7-15(11,4)14(10,2)3/h10-11H,5-9H2,1-4H3,(H,16,18)(H,17,19)/t10-,11-,15+/m0/s1 |
| InChIKey | RPXWSYIGQMXSEW-ZIBATOQPSA-N |
| XLogP | 1.78 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|