C21H39N2O4+ — CID 98102730
(1,3-diethoxy-1,3-dioxopropan-2-yl)-[(1R,2S,3R,4R)-3-(dimethylamino)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]-dimethylazanium (PubChem CID 98102730) has the molecular formula C21H39N2O4+ and a molecular weight of 383.55 g/mol. Its IUPAC name is (1,3-diethoxy-1,3-dioxopropan-2-yl)-[(1R,2S,3R,4R)-3-(dimethylamino)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]-dimethylazanium.
| Compound Name | (1,3-diethoxy-1,3-dioxopropan-2-yl)-[(1R,2S,3R,4R)-3-(dimethylamino)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]-dimethylazanium |
|---|---|
| PubChem CID | 98102730 |
| Molecular Formula | C21H39N2O4+ |
| Molecular Weight | 383.55 g/mol |
| Exact Mass | 383.29 |
| IUPAC Name | (1,3-diethoxy-1,3-dioxopropan-2-yl)-[(1R,2S,3R,4R)-3-(dimethylamino)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]-dimethylazanium |
| SMILES | CCOC(=O)C(C(=O)OCC)[N+](C)(C)[C@@H]1[C@H](N(C)C)[C@@H]2CC[C@]1(C)C2(C)C |
| InChI | InChI=1S/C21H39N2O4/c1-10-26-18(24)16(19(25)27-11-2)23(8,9)17-15(22(6)7)14-12-13-21(17,5)20(14,3)4/h14-17H,10-13H2,1-9H3/q+1/t14-,15+,17+,21-/m0/s1 |
| InChIKey | POZMUPUNEIKAIE-GAPZROTKSA-N |
| XLogP | 2.31 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.55 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|