C17H28O4S — CID 101270366
ethyl (E)-3-[[(2R,3S,4R)-3-methoxy-4,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]sulfinyl]but-2-enoate (PubChem CID 101270366) has the molecular formula C17H28O4S and a molecular weight of 328.47 g/mol. Its IUPAC name is ethyl (E)-3-[[(2R,3S,4R)-3-methoxy-4,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]sulfinyl]but-2-enoate.
| Compound Name | ethyl (E)-3-[[(2R,3S,4R)-3-methoxy-4,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]sulfinyl]but-2-enoate |
|---|---|
| PubChem CID | 101270366 |
| Molecular Formula | C17H28O4S |
| Molecular Weight | 328.47 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | ethyl (E)-3-[[(2R,3S,4R)-3-methoxy-4,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]sulfinyl]but-2-enoate |
| SMILES | CCOC(=O)/C=C(\C)S(=O)[C@@H]1C2CC[C@@](C)([C@@H]1OC)C2(C)C |
| InChI | InChI=1S/C17H28O4S/c1-7-21-13(18)10-11(2)22(19)14-12-8-9-17(5,15(14)20-6)16(12,3)4/h10,12,14-15H,7-9H2,1-6H3/b11-10+/t12?,14-,15-,17+,22?/m1/s1 |
| InChIKey | LQYJOCDOBNWXIQ-QHBMEYDVSA-N |
| XLogP | 3.04 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.47 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|