C16H23NO3S — CID 10733699
(NE,S,1S,2R,3S,4R)-N-(furan-2-ylmethylidene)-3-methoxy-4,7,7-trimethylbicyclo[2.2.1]heptane-2-sulfinamide (PubChem CID 10733699) has the molecular formula C16H23NO3S and a molecular weight of 309.43 g/mol. Its IUPAC name is (NE,S,1S,2R,3S,4R)-N-(furan-2-ylmethylidene)-3-methoxy-4,7,7-trimethylbicyclo[2.2.1]heptane-2-sulfinamide.
| Compound Name | (NE,S,1S,2R,3S,4R)-N-(furan-2-ylmethylidene)-3-methoxy-4,7,7-trimethylbicyclo[2.2.1]heptane-2-sulfinamide |
|---|---|
| PubChem CID | 10733699 |
| Molecular Formula | C16H23NO3S |
| Molecular Weight | 309.43 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | (NE,S,1S,2R,3S,4R)-N-(furan-2-ylmethylidene)-3-methoxy-4,7,7-trimethylbicyclo[2.2.1]heptane-2-sulfinamide |
| SMILES | CO[C@@H]1[C@H]([S@](=O)/N=C/c2ccco2)[C@H]2CC[C@]1(C)C2(C)C |
| InChI | InChI=1S/C16H23NO3S/c1-15(2)12-7-8-16(15,3)14(19-4)13(12)21(18)17-10-11-6-5-9-20-11/h5-6,9-10,12-14H,7-8H2,1-4H3/b17-10+/t12-,13-,14-,16+,21+/m1/s1 |
| InChIKey | UQEVLGPNYQVEMA-ZRRMSEPLSA-N |
| XLogP | 3.20 |
| TPSA | 51.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.43 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|