C20H27NO2S — CID 10759967
(NE,S,1S,2R,3S,4R)-3-methoxy-4,7,7-trimethyl-N-[(E)-3-phenylprop-2-enylidene]bicyclo[2.2.1]heptane-2-sulfinamide (PubChem CID 10759967) has the molecular formula C20H27NO2S and a molecular weight of 345.51 g/mol. Its IUPAC name is (NE,S,1S,2R,3S,4R)-3-methoxy-4,7,7-trimethyl-N-[(E)-3-phenylprop-2-enylidene]bicyclo[2.2.1]heptane-2-sulfinamide.
| Compound Name | (NE,S,1S,2R,3S,4R)-3-methoxy-4,7,7-trimethyl-N-[(E)-3-phenylprop-2-enylidene]bicyclo[2.2.1]heptane-2-sulfinamide |
|---|---|
| PubChem CID | 10759967 |
| Molecular Formula | C20H27NO2S |
| Molecular Weight | 345.51 g/mol |
| Exact Mass | 345.18 |
| IUPAC Name | (NE,S,1S,2R,3S,4R)-3-methoxy-4,7,7-trimethyl-N-[(E)-3-phenylprop-2-enylidene]bicyclo[2.2.1]heptane-2-sulfinamide |
| SMILES | CO[C@@H]1[C@H]([S@](=O)/N=C/C=C/c2ccccc2)[C@H]2CC[C@]1(C)C2(C)C |
| InChI | InChI=1S/C20H27NO2S/c1-19(2)16-12-13-20(19,3)18(23-4)17(16)24(22)21-14-8-11-15-9-6-5-7-10-15/h5-11,14,16-18H,12-13H2,1-4H3/b11-8+,21-14+/t16-,17-,18-,20+,24+/m1/s1 |
| InChIKey | VDVNFMGZWFWCHK-OHFUGUOYSA-N |
| XLogP | 4.27 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.51 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|