C26H29NOSe — CID 102511128
(1S,2S,6R,7R)-1,10,10-trimethyl-4-[2-[(E)-3-phenylprop-2-enyl]selanylphenyl]-3-oxa-5-azatricyclo[5.2.1.02,6]dec-4-ene (PubChem CID 102511128) has the molecular formula C26H29NOSe and a molecular weight of 450.48 g/mol. Its IUPAC name is (1S,2S,6R,7R)-1,10,10-trimethyl-4-[2-[(E)-3-phenylprop-2-enyl]selanylphenyl]-3-oxa-5-azatricyclo[5.2.1.02,6]dec-4-ene.
| Compound Name | (1S,2S,6R,7R)-1,10,10-trimethyl-4-[2-[(E)-3-phenylprop-2-enyl]selanylphenyl]-3-oxa-5-azatricyclo[5.2.1.02,6]dec-4-ene |
|---|---|
| PubChem CID | 102511128 |
| Molecular Formula | C26H29NOSe |
| Molecular Weight | 450.48 g/mol |
| Exact Mass | 451.14 |
| IUPAC Name | (1S,2S,6R,7R)-1,10,10-trimethyl-4-[2-[(E)-3-phenylprop-2-enyl]selanylphenyl]-3-oxa-5-azatricyclo[5.2.1.02,6]dec-4-ene |
| SMILES | CC1(C)[C@H]2CC[C@]1(C)[C@@H]1OC(c3ccccc3[Se]C/C=C/c3ccccc3)=N[C@@H]12 |
| InChI | InChI=1S/C26H29NOSe/c1-25(2)20-15-16-26(25,3)23-22(20)27-24(28-23)19-13-7-8-14-21(19)29-17-9-12-18-10-5-4-6-11-18/h4-14,20,22-23H,15-17H2,1-3H3/b12-9+/t20-,22+,23+,26+/m0/s1 |
| InChIKey | VZZLUJXVRJYYIB-WDXVKEMKSA-N |
| XLogP | 5.12 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.48 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|