C16H20O2 — CID 15415733
(3R)-6,6-dimethyl-3-[(E)-3-phenylprop-2-enyl]oxan-2-one (PubChem CID 15415733) has the molecular formula C16H20O2 and a molecular weight of 244.33 g/mol. Its IUPAC name is (3R)-6,6-dimethyl-3-[(E)-3-phenylprop-2-enyl]oxan-2-one.
| Compound Name | (3R)-6,6-dimethyl-3-[(E)-3-phenylprop-2-enyl]oxan-2-one |
|---|---|
| PubChem CID | 15415733 |
| Molecular Formula | C16H20O2 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.15 |
| IUPAC Name | (3R)-6,6-dimethyl-3-[(E)-3-phenylprop-2-enyl]oxan-2-one |
| SMILES | CC1(C)CC[C@H](C/C=C/c2ccccc2)C(=O)O1 |
| InChI | InChI=1S/C16H20O2/c1-16(2)12-11-14(15(17)18-16)10-6-9-13-7-4-3-5-8-13/h3-9,14H,10-12H2,1-2H3/b9-6+/t14-/m0/s1 |
| InChIKey | SGSWLFNTXYYRQP-MRZGDXHCSA-N |
| XLogP | 3.82 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |