C15H15IO2 — CID 45276563
4-iodo-5,5-dimethyl-3-[(E)-3-phenylprop-2-enyl]furan-2-one (PubChem CID 45276563) has the molecular formula C15H15IO2 and a molecular weight of 354.19 g/mol. Its IUPAC name is 4-iodo-5,5-dimethyl-3-[(E)-3-phenylprop-2-enyl]furan-2-one.
| Compound Name | 4-iodo-5,5-dimethyl-3-[(E)-3-phenylprop-2-enyl]furan-2-one |
|---|---|
| PubChem CID | 45276563 |
| Molecular Formula | C15H15IO2 |
| Molecular Weight | 354.19 g/mol |
| Exact Mass | 354.01 |
| IUPAC Name | 4-iodo-5,5-dimethyl-3-[(E)-3-phenylprop-2-enyl]furan-2-one |
| SMILES | CC1(C)OC(=O)C(C/C=C/c2ccccc2)=C1I |
| InChI | InChI=1S/C15H15IO2/c1-15(2)13(16)12(14(17)18-15)10-6-9-11-7-4-3-5-8-11/h3-9H,10H2,1-2H3/b9-6+ |
| InChIKey | SAFJPURNFRCCST-RMKNXTFCSA-N |
| XLogP | 4.11 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.19 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|