C19H24O — CID 101452751
trans-(1R,3R)-1,2,2-trimethyl-3-[(1E,3E)-4-phenylbuta-1,3-dienyl]cyclopentane-1-carbaldehyde (PubChem CID 101452751) has the molecular formula C19H24O and a molecular weight of 268.40 g/mol. Its IUPAC name is trans-(1R,3R)-1,2,2-trimethyl-3-[(1E,3E)-4-phenylbuta-1,3-dienyl]cyclopentane-1-carbaldehyde.
| Compound Name | trans-(1R,3R)-1,2,2-trimethyl-3-[(1E,3E)-4-phenylbuta-1,3-dienyl]cyclopentane-1-carbaldehyde |
|---|---|
| PubChem CID | 101452751 |
| Molecular Formula | C19H24O |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | trans-(1R,3R)-1,2,2-trimethyl-3-[(1E,3E)-4-phenylbuta-1,3-dienyl]cyclopentane-1-carbaldehyde |
| SMILES | CC1(C)[C@@H](/C=C/C=C/c2ccccc2)CC[C@@]1(C)C=O |
| InChI | InChI=1S/C19H24O/c1-18(2)17(13-14-19(18,3)15-20)12-8-7-11-16-9-5-4-6-10-16/h4-12,15,17H,13-14H2,1-3H3/b11-7+,12-8+/t17-,19-/m0/s1 |
| InChIKey | ILUWREJHQCRJSL-CELPLJLLSA-N |
| XLogP | 4.90 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|