C15H16O3 — CID 125479499
(5S)-2,2-dimethyl-5-[(1E,3E)-4-phenylbuta-1,3-dienyl]-1,3-dioxolan-4-one (PubChem CID 125479499) has the molecular formula C15H16O3 and a molecular weight of 244.29 g/mol. Its IUPAC name is (5S)-2,2-dimethyl-5-[(1E,3E)-4-phenylbuta-1,3-dienyl]-1,3-dioxolan-4-one.
| Compound Name | (5S)-2,2-dimethyl-5-[(1E,3E)-4-phenylbuta-1,3-dienyl]-1,3-dioxolan-4-one |
|---|---|
| PubChem CID | 125479499 |
| Molecular Formula | C15H16O3 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | (5S)-2,2-dimethyl-5-[(1E,3E)-4-phenylbuta-1,3-dienyl]-1,3-dioxolan-4-one |
| SMILES | CC1(C)OC(=O)[C@H](/C=C/C=C/c2ccccc2)O1 |
| InChI | InChI=1S/C15H16O3/c1-15(2)17-13(14(16)18-15)11-7-6-10-12-8-4-3-5-9-12/h3-11,13H,1-2H3/b10-6+,11-7+/t13-/m0/s1 |
| InChIKey | FEVYIPTXCFHDJJ-FEPYOZFYSA-N |
| XLogP | 2.93 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|