C16H22O2 — CID 11673198
(4R,5S,6R)-2,2,4,5-tetramethyl-6-[(E)-2-phenylethenyl]-1,3-dioxane (PubChem CID 11673198) has the molecular formula C16H22O2 and a molecular weight of 246.35 g/mol. Its IUPAC name is (4R,5S,6R)-2,2,4,5-tetramethyl-6-[(E)-2-phenylethenyl]-1,3-dioxane.
| Compound Name | (4R,5S,6R)-2,2,4,5-tetramethyl-6-[(E)-2-phenylethenyl]-1,3-dioxane |
|---|---|
| PubChem CID | 11673198 |
| Molecular Formula | C16H22O2 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.16 |
| IUPAC Name | (4R,5S,6R)-2,2,4,5-tetramethyl-6-[(E)-2-phenylethenyl]-1,3-dioxane |
| SMILES | C[C@H]1[C@@H](C)OC(C)(C)O[C@@H]1/C=C/c1ccccc1 |
| InChI | InChI=1S/C16H22O2/c1-12-13(2)17-16(3,4)18-15(12)11-10-14-8-6-5-7-9-14/h5-13,15H,1-4H3/b11-10+/t12-,13+,15+/m0/s1 |
| InChIKey | PUNPUWCEGLAUJQ-DLDHWWSZSA-N |
| XLogP | 3.88 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |