C17H21O2- — CID 4660169
1,2,2-trimethyl-3-(2-phenylethenyl)cyclopentane-1-carboxylate (PubChem CID 4660169) has the molecular formula C17H21O2- and a molecular weight of 257.35 g/mol. Its IUPAC name is 1,2,2-trimethyl-3-(2-phenylethenyl)cyclopentane-1-carboxylate.
| Compound Name | 1,2,2-trimethyl-3-(2-phenylethenyl)cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 4660169 |
| Molecular Formula | C17H21O2- |
| Molecular Weight | 257.35 g/mol |
| Exact Mass | 257.15 |
| IUPAC Name | 1,2,2-trimethyl-3-(2-phenylethenyl)cyclopentane-1-carboxylate |
| SMILES | CC1(C(=O)[O-])CCC(C=Cc2ccccc2)C1(C)C |
| InChI | InChI=1S/C17H22O2/c1-16(2)14(11-12-17(16,3)15(18)19)10-9-13-7-5-4-6-8-13/h4-10,14H,11-12H2,1-3H3,(H,18,19)/p-1 |
| InChIKey | JHNAXAWXCMJBGR-UHFFFAOYSA-M |
| XLogP | 2.89 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.35 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |