C10H14CaO4 — CID 140570335
calcium 1,2,2-trimethylcyclopentane-1,3-dicarboxylate (PubChem CID 140570335) has the molecular formula C10H14CaO4 and a molecular weight of 238.30 g/mol. Its IUPAC name is calcium 1,2,2-trimethylcyclopentane-1,3-dicarboxylate.
| Compound Name | calcium 1,2,2-trimethylcyclopentane-1,3-dicarboxylate |
|---|---|
| PubChem CID | 140570335 |
| Molecular Formula | C10H14CaO4 |
| Molecular Weight | 238.30 g/mol |
| Exact Mass | 238.05 |
| IUPAC Name | calcium 1,2,2-trimethylcyclopentane-1,3-dicarboxylate |
| SMILES | CC1(C(=O)[O-])CCC(C(=O)[O-])C1(C)C.[Ca+2] |
| InChI | InChI=1S/C10H16O4.Ca/c1-9(2)6(7(11)12)4-5-10(9,3)8(13)14;/h6H,4-5H2,1-3H3,(H,11,12)(H,13,14);/q;+2/p-2 |
| InChIKey | ZONBDOHENQUJBH-UHFFFAOYSA-L |
| XLogP | -1.45 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.30 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |