C13H18N3O3S- — CID 6920772
cis-(1R,3R)-1,2,2-trimethyl-3-[(5-methyl-1,3,4-thiadiazol-2-yl)carbamoyl]cyclopentane-1-carboxylate (PubChem CID 6920772) has the molecular formula C13H18N3O3S- and a molecular weight of 296.37 g/mol. Its IUPAC name is cis-(1R,3R)-1,2,2-trimethyl-3-[(5-methyl-1,3,4-thiadiazol-2-yl)carbamoyl]cyclopentane-1-carboxylate.
| Compound Name | cis-(1R,3R)-1,2,2-trimethyl-3-[(5-methyl-1,3,4-thiadiazol-2-yl)carbamoyl]cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 6920772 |
| Molecular Formula | C13H18N3O3S- |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | cis-(1R,3R)-1,2,2-trimethyl-3-[(5-methyl-1,3,4-thiadiazol-2-yl)carbamoyl]cyclopentane-1-carboxylate |
| SMILES | Cc1nnc(NC(=O)[C@@H]2CC[C@@](C)(C(=O)[O-])C2(C)C)s1 |
| InChI | InChI=1S/C13H19N3O3S/c1-7-15-16-11(20-7)14-9(17)8-5-6-13(4,10(18)19)12(8,2)3/h8H,5-6H2,1-4H3,(H,18,19)(H,14,16,17)/p-1/t8-,13-/m0/s1 |
| InChIKey | RRCVKNDENKFZJJ-SDBXPKJASA-M |
| XLogP | 0.98 |
| TPSA | 95.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |