C13H19N3O3S — CID 681919
cis-(1R,3R)-1,2,2-trimethyl-3-[(5-methyl-1,3,4-thiadiazol-2-yl)carbamoyl]cyclopentane-1-carboxylic acid (PubChem CID 681919) has the molecular formula C13H19N3O3S and a molecular weight of 297.38 g/mol. Its IUPAC name is cis-(1R,3R)-1,2,2-trimethyl-3-[(5-methyl-1,3,4-thiadiazol-2-yl)carbamoyl]cyclopentane-1-carboxylic acid.
| Compound Name | cis-(1R,3R)-1,2,2-trimethyl-3-[(5-methyl-1,3,4-thiadiazol-2-yl)carbamoyl]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 681919 |
| Molecular Formula | C13H19N3O3S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | cis-(1R,3R)-1,2,2-trimethyl-3-[(5-methyl-1,3,4-thiadiazol-2-yl)carbamoyl]cyclopentane-1-carboxylic acid |
| SMILES | Cc1nnc(NC(=O)[C@@H]2CC[C@@](C)(C(=O)O)C2(C)C)s1 |
| InChI | InChI=1S/C13H19N3O3S/c1-7-15-16-11(20-7)14-9(17)8-5-6-13(4,10(18)19)12(8,2)3/h8H,5-6H2,1-4H3,(H,18,19)(H,14,16,17)/t8-,13-/m0/s1 |
| InChIKey | RRCVKNDENKFZJJ-SDBXPKJASA-N |
| XLogP | 2.31 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |