C12H22N2O3 — CID 3114926
3-(dimethylaminocarbamoyl)-1,2,2-trimethylcyclopentane-1-carboxylic acid (PubChem CID 3114926) has the molecular formula C12H22N2O3 and a molecular weight of 242.32 g/mol. Its IUPAC name is 3-(dimethylaminocarbamoyl)-1,2,2-trimethylcyclopentane-1-carboxylic acid.
| Compound Name | 3-(dimethylaminocarbamoyl)-1,2,2-trimethylcyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 3114926 |
| Molecular Formula | C12H22N2O3 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.16 |
| IUPAC Name | 3-(dimethylaminocarbamoyl)-1,2,2-trimethylcyclopentane-1-carboxylic acid |
| SMILES | CN(C)NC(=O)C1CCC(C)(C(=O)O)C1(C)C |
| InChI | InChI=1S/C12H22N2O3/c1-11(2)8(9(15)13-14(4)5)6-7-12(11,3)10(16)17/h8H,6-7H2,1-5H3,(H,13,15)(H,16,17) |
| InChIKey | GEHRKPJONVTCMU-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|