C17H26N2O4 — CID 6543629
cis-(1S,3S)-1,2,2-trimethyl-3-[[[(2R)-spiro[2.3]hexane-2-carbonyl]amino]carbamoyl]cyclopentane-1-carboxylic acid (PubChem CID 6543629) has the molecular formula C17H26N2O4 and a molecular weight of 322.41 g/mol. Its IUPAC name is cis-(1S,3S)-1,2,2-trimethyl-3-[[[(2R)-spiro[2.3]hexane-2-carbonyl]amino]carbamoyl]cyclopentane-1-carboxylic acid.
| Compound Name | cis-(1S,3S)-1,2,2-trimethyl-3-[[[(2R)-spiro[2.3]hexane-2-carbonyl]amino]carbamoyl]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 6543629 |
| Molecular Formula | C17H26N2O4 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | cis-(1S,3S)-1,2,2-trimethyl-3-[[[(2R)-spiro[2.3]hexane-2-carbonyl]amino]carbamoyl]cyclopentane-1-carboxylic acid |
| SMILES | CC1(C)[C@@H](C(=O)NNC(=O)[C@@H]2CC23CCC3)CC[C@]1(C)C(=O)O |
| InChI | InChI=1S/C17H26N2O4/c1-15(2)10(5-8-16(15,3)14(22)23)12(20)18-19-13(21)11-9-17(11)6-4-7-17/h10-11H,4-9H2,1-3H3,(H,18,20)(H,19,21)(H,22,23)/t10-,11+,16-/m1/s1 |
| InChIKey | ZLMAKDIFBKUXJD-OHUAYANFSA-N |
| XLogP | 1.85 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|