C17H21ClN2O4 — CID 7037597
trans-(1R,3S)-3-[[(2-chlorobenzoyl)amino]carbamoyl]-1,2,2-trimethylcyclopentane-1-carboxylic acid (PubChem CID 7037597) has the molecular formula C17H21ClN2O4 and a molecular weight of 352.82 g/mol. Its IUPAC name is trans-(1R,3S)-3-[[(2-chlorobenzoyl)amino]carbamoyl]-1,2,2-trimethylcyclopentane-1-carboxylic acid.
| Compound Name | trans-(1R,3S)-3-[[(2-chlorobenzoyl)amino]carbamoyl]-1,2,2-trimethylcyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 7037597 |
| Molecular Formula | C17H21ClN2O4 |
| Molecular Weight | 352.82 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | trans-(1R,3S)-3-[[(2-chlorobenzoyl)amino]carbamoyl]-1,2,2-trimethylcyclopentane-1-carboxylic acid |
| SMILES | CC1(C)[C@@H](C(=O)NNC(=O)c2ccccc2Cl)CC[C@@]1(C)C(=O)O |
| InChI | InChI=1S/C17H21ClN2O4/c1-16(2)11(8-9-17(16,3)15(23)24)14(22)20-19-13(21)10-6-4-5-7-12(10)18/h4-7,11H,8-9H2,1-3H3,(H,19,21)(H,20,22)(H,23,24)/t11-,17+/m1/s1 |
| InChIKey | YEASDIDAPOSPIL-DIFFPNOSSA-N |
| XLogP | 2.63 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.82 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|