C9H14N2O2 — CID 840558
(2S)-N'-acetylspiro[2.3]hexane-2-carbohydrazide (PubChem CID 840558) has the molecular formula C9H14N2O2 and a molecular weight of 182.22 g/mol. Its IUPAC name is (2S)-N'-acetylspiro[2.3]hexane-2-carbohydrazide.
| Compound Name | (2S)-N'-acetylspiro[2.3]hexane-2-carbohydrazide |
|---|---|
| PubChem CID | 840558 |
| Molecular Formula | C9H14N2O2 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | (2S)-N'-acetylspiro[2.3]hexane-2-carbohydrazide |
| SMILES | CC(=O)NNC(=O)[C@H]1CC12CCC2 |
| InChI | InChI=1S/C9H14N2O2/c1-6(12)10-11-8(13)7-5-9(7)3-2-4-9/h7H,2-5H2,1H3,(H,10,12)(H,11,13)/t7-/m1/s1 |
| InChIKey | LLDUOAHPARNRBD-SSDOTTSWSA-N |
| XLogP | 0.34 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|