C11H17NO — CID 130891244
N-(2-methylprop-2-enyl)spiro[2.3]hexane-2-carboxamide (PubChem CID 130891244) has the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. Its IUPAC name is N-(2-methylprop-2-enyl)spiro[2.3]hexane-2-carboxamide.
| Compound Name | N-(2-methylprop-2-enyl)spiro[2.3]hexane-2-carboxamide |
|---|---|
| PubChem CID | 130891244 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | N-(2-methylprop-2-enyl)spiro[2.3]hexane-2-carboxamide |
| SMILES | C=C(C)CNC(=O)C1CC12CCC2 |
| InChI | InChI=1S/C11H17NO/c1-8(2)7-12-10(13)9-6-11(9)4-3-5-11/h9H,1,3-7H2,2H3,(H,12,13) |
| InChIKey | YXLLROMEXMUZLA-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|