C11H14O5-2 — CID 7054438
cis-(1S,3S)-3-(carboxylatoformyl)-2,2,3-trimethylcyclopentane-1-carboxylate (PubChem CID 7054438) has the molecular formula C11H14O5-2 and a molecular weight of 226.23 g/mol. Its IUPAC name is cis-(1S,3S)-3-(carboxylatoformyl)-2,2,3-trimethylcyclopentane-1-carboxylate.
| Compound Name | cis-(1S,3S)-3-(carboxylatoformyl)-2,2,3-trimethylcyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 7054438 |
| Molecular Formula | C11H14O5-2 |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.09 |
| IUPAC Name | cis-(1S,3S)-3-(carboxylatoformyl)-2,2,3-trimethylcyclopentane-1-carboxylate |
| SMILES | CC1(C)[C@@H](C(=O)[O-])CC[C@]1(C)C(=O)C(=O)[O-] |
| InChI | InChI=1S/C11H16O5/c1-10(2)6(8(13)14)4-5-11(10,3)7(12)9(15)16/h6H,4-5H2,1-3H3,(H,13,14)(H,15,16)/p-2/t6-,11-/m1/s1 |
| InChIKey | PIJZJDNPYOBFDM-KSBSHMNSSA-L |
| XLogP | -1.50 |
| TPSA | 97.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|