C10H14Cl2O2 — CID 165352423
trans-(1S,3R)-1,2,2-trimethylcyclopentane-1,3-dicarbonyl chloride (PubChem CID 165352423) has the molecular formula C10H14Cl2O2 and a molecular weight of 237.13 g/mol. Its IUPAC name is trans-(1S,3R)-1,2,2-trimethylcyclopentane-1,3-dicarbonyl chloride.
| Compound Name | trans-(1S,3R)-1,2,2-trimethylcyclopentane-1,3-dicarbonyl chloride |
|---|---|
| PubChem CID | 165352423 |
| Molecular Formula | C10H14Cl2O2 |
| Molecular Weight | 237.13 g/mol |
| Exact Mass | 236.04 |
| IUPAC Name | trans-(1S,3R)-1,2,2-trimethylcyclopentane-1,3-dicarbonyl chloride |
| SMILES | CC1(C)[C@H](C(=O)Cl)CC[C@]1(C)C(=O)Cl |
| InChI | InChI=1S/C10H14Cl2O2/c1-9(2)6(7(11)13)4-5-10(9,3)8(12)14/h6H,4-5H2,1-3H3/t6-,10+/m0/s1 |
| InChIKey | JEIWMMMVZOQQHT-QUBYGPBYSA-N |
| XLogP | 2.96 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.13 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|