C10H14BaO4 — CID 158507106
barium(2+);1,2,2-trimethylcyclopentane-1,3-dicarboxylate (PubChem CID 158507106) has the molecular formula C10H14BaO4 and a molecular weight of 335.55 g/mol. Its IUPAC name is barium(2+);1,2,2-trimethylcyclopentane-1,3-dicarboxylate.
| Compound Name | barium(2+);1,2,2-trimethylcyclopentane-1,3-dicarboxylate |
|---|---|
| PubChem CID | 158507106 |
| Molecular Formula | C10H14BaO4 |
| Molecular Weight | 335.55 g/mol |
| Exact Mass | 335.99 |
| IUPAC Name | barium(2+);1,2,2-trimethylcyclopentane-1,3-dicarboxylate |
| SMILES | CC1(C(=O)[O-])CCC(C(=O)[O-])C1(C)C.[Ba+2] |
| InChI | InChI=1S/C10H16O4.Ba/c1-9(2)6(7(11)12)4-5-10(9,3)8(13)14;/h6H,4-5H2,1-3H3,(H,11,12)(H,13,14);/q;+2/p-2 |
| InChIKey | HKPCLRRNINFGBF-UHFFFAOYSA-L |
| XLogP | -1.45 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.55 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |