C10H16BrO2- — CID 7053976
cis-(1S,3S)-3-(bromomethyl)-1,2,2-trimethylcyclopentane-1-carboxylate (PubChem CID 7053976) has the molecular formula C10H16BrO2- and a molecular weight of 248.14 g/mol. Its IUPAC name is cis-(1S,3S)-3-(bromomethyl)-1,2,2-trimethylcyclopentane-1-carboxylate.
| Compound Name | cis-(1S,3S)-3-(bromomethyl)-1,2,2-trimethylcyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 7053976 |
| Molecular Formula | C10H16BrO2- |
| Molecular Weight | 248.14 g/mol |
| Exact Mass | 247.03 |
| IUPAC Name | cis-(1S,3S)-3-(bromomethyl)-1,2,2-trimethylcyclopentane-1-carboxylate |
| SMILES | CC1(C)[C@@H](CBr)CC[C@]1(C)C(=O)[O-] |
| InChI | InChI=1S/C10H17BrO2/c1-9(2)7(6-11)4-5-10(9,3)8(12)13/h7H,4-6H2,1-3H3,(H,12,13)/p-1/t7-,10-/m1/s1 |
| InChIKey | YQVIHPCUIKAVMS-GMSGAONNSA-M |
| XLogP | 1.57 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.14 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|