C19H26O3 — CID 67727092
3-phenylprop-2-enoic acid;1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol (PubChem CID 67727092) has the molecular formula C19H26O3 and a molecular weight of 302.41 g/mol. Its IUPAC name is 3-phenylprop-2-enoic acid;1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol.
| Compound Name | 3-phenylprop-2-enoic acid;1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol |
|---|---|
| PubChem CID | 67727092 |
| Molecular Formula | C19H26O3 |
| Molecular Weight | 302.41 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | 3-phenylprop-2-enoic acid;1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol |
| SMILES | CC1(C)C2CCC1(C)C(O)C2.O=C(O)C=Cc1ccccc1 |
| InChI | InChI=1S/C10H18O.C9H8O2/c1-9(2)7-4-5-10(9,3)8(11)6-7;10-9(11)7-6-8-4-2-1-3-5-8/h7-8,11H,4-6H2,1-3H3;1-7H,(H,10,11) |
| InChIKey | GCKDYPNYKWHWFI-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.41 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|