C10H21NO — CID 174585091
azane;(1S,2S,4R)-1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol (PubChem CID 174585091) has the molecular formula C10H21NO and a molecular weight of 171.28 g/mol. Its IUPAC name is azane;(1S,2S,4R)-1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol.
| Compound Name | azane;(1S,2S,4R)-1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol |
|---|---|
| PubChem CID | 174585091 |
| Molecular Formula | C10H21NO |
| Molecular Weight | 171.28 g/mol |
| Exact Mass | 171.16 |
| IUPAC Name | azane;(1S,2S,4R)-1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol |
| SMILES | CC1(C)[C@@H]2CC[C@]1(C)[C@@H](O)C2.N |
| InChI | InChI=1S/C10H18O.H3N/c1-9(2)7-4-5-10(9,3)8(11)6-7;/h7-8,11H,4-6H2,1-3H3;1H3/t7-,8+,10-;/m1./s1 |
| InChIKey | WJTNPHJLHGGTTK-JUHCGIOYSA-N |
| XLogP | 2.36 |
| TPSA | 55.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.28 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |