C20H36O2 — CID 135369493
(1S,2R,4R)-1,3,3-trimethylbicyclo[2.2.1]heptan-2-ol;(1S,2S,4S)-1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol (PubChem CID 135369493) has the molecular formula C20H36O2 and a molecular weight of 308.51 g/mol. Its IUPAC name is (1S,2R,4R)-1,3,3-trimethylbicyclo[2.2.1]heptan-2-ol;(1S,2S,4S)-1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol.
| Compound Name | (1S,2R,4R)-1,3,3-trimethylbicyclo[2.2.1]heptan-2-ol;(1S,2S,4S)-1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol |
|---|---|
| PubChem CID | 135369493 |
| Molecular Formula | C20H36O2 |
| Molecular Weight | 308.51 g/mol |
| Exact Mass | 308.27 |
| IUPAC Name | (1S,2R,4R)-1,3,3-trimethylbicyclo[2.2.1]heptan-2-ol;(1S,2S,4S)-1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol |
| SMILES | CC1(C)[C@@H]2CC[C@@](C)(C2)[C@H]1O.CC1(C)[C@H]2CC[C@]1(C)[C@@H](O)C2 |
| InChI | InChI=1S/2C10H18O/c1-9(2)7-4-5-10(3,6-7)8(9)11;1-9(2)7-4-5-10(9,3)8(11)6-7/h2*7-8,11H,4-6H2,1-3H3/t7-,8+,10+;7-,8-,10+/m10/s1 |
| InChIKey | FZBZOYJTZLJWPV-XHODTWGGSA-N |
| XLogP | 4.39 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.51 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |