C10H21O5P — CID 175476100
phosphoric acid;(1S,2S,4R)-1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol (PubChem CID 175476100) has the molecular formula C10H21O5P and a molecular weight of 252.25 g/mol. Its IUPAC name is phosphoric acid;(1S,2S,4R)-1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol.
| Compound Name | phosphoric acid;(1S,2S,4R)-1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol |
|---|---|
| PubChem CID | 175476100 |
| Molecular Formula | C10H21O5P |
| Molecular Weight | 252.25 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | phosphoric acid;(1S,2S,4R)-1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol |
| SMILES | CC1(C)[C@@H]2CC[C@]1(C)[C@@H](O)C2.O=P(O)(O)O |
| InChI | InChI=1S/C10H18O.H3O4P/c1-9(2)7-4-5-10(9,3)8(11)6-7;1-5(2,3)4/h7-8,11H,4-6H2,1-3H3;(H3,1,2,3,4)/t7-,8+,10-;/m1./s1 |
| InChIKey | NJAPBGZUFFUACF-JUHCGIOYSA-N |
| XLogP | 1.26 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.25 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|